1,2-Diamino-4,5-methylenedioxybenzene,Dihydrochloride
Catalog No: FT-0666380
CAS No: 81864-15-5
- Chemical Name: 1,2-Diamino-4,5-methylenedioxybenzene,Dihydrochloride
- Molecular Formula: C7H10Cl2N2O2
- Molecular Weight: 225.07
- InChI Key: YXEJRYIEFFUUID-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8N2O2.2ClH/c8-4-1-6-7(2-5(4)9)11-3-10-6;;/h1-2H,3,8-9H2;2*1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 188.612 |
| Density: | N/A |
| CAS: | 81864-15-5 |
| Bolling_Point: | 394.6ºC at 760 mmHg |
| Product_Name: | 1,2-Diamino-4,5-methylenedioxybenzene,dihydrochloride |
| Melting_Point: | 247-249ºC |
| Flash_Point: | 192.4ºC |
| MF: | C7H9ClN2O2 |
| LogP: | 3.34610 |
|---|---|
| Flash_Point: | 192.4ºC |
| Melting_Point: | 247-249ºC |
| FW: | 188.612 |
| PSA: | 70.50000 |
| MF: | C7H9ClN2O2 |
| Bolling_Point: | 394.6ºC at 760 mmHg |
| Exact_Mass: | 188.035248 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)