5,6-Diamino-1,3-dipropyluracil
Catalog No: FT-0666367
CAS No: 81250-34-2
- Chemical Name: 5,6-Diamino-1,3-dipropyluracil
- Molecular Formula: C10H18N4O2
- Molecular Weight: 226.28
- InChI Key: SVMBOONGPUFHRA-UHFFFAOYSA-N
- InChI: InChI=1S/C10H18N4O2/c1-3-5-13-8(12)7(11)9(15)14(6-4-2)10(13)16/h3-6,11-12H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 226.275 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 81250-34-2 |
| Bolling_Point: | 311.2±52.0 °C at 760 mmHg |
| Product_Name: | 5,6-Diamino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione |
| Melting_Point: | 128-132ºC |
| Flash_Point: | 142.0±30.7 °C |
| MF: | C10H18N4O2 |
| LogP: | 0.43 |
|---|---|
| Flash_Point: | 142.0±30.7 °C |
| Refractive_Index: | 1.535 |
| FW: | 226.275 |
| Bolling_Point: | 311.2±52.0 °C at 760 mmHg |
| Density: | 1.2±0.1 g/cm3 |
| Melting_Point: | 128-132ºC |
| PSA: | 96.04000 |
| Exact_Mass: | 226.142975 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C10H18N4O2 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)