3-AMINO-2-OXAZOLIDINONE
Catalog No: FT-0614939
CAS No: 80-65-9
- Chemical Name: 3-AMINO-2-OXAZOLIDINONE
- Molecular Formula: C3H6N2O2
- Molecular Weight: 102.09
- InChI Key: KYCJNIUHWNJNCT-UHFFFAOYSA-N
- InChI: InChI=1S/C3H6N2O2/c4-5-1-2-7-3(5)6/h1-2,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 80-65-9 |
| Flash_Point: | 54.9±22.6 °C |
| Product_Name: | 3-Amino-2-oxazolidone |
| Bolling_Point: | 167.2±23.0 °C at 760 mmHg |
| FW: | 102.092 |
| Melting_Point: | 65-67ºC |
| MF: | C3H6N2O2 |
| Density: | 1.4±0.1 g/cm3 |
| Melting_Point: | 65-67ºC |
|---|---|
| Refractive_Index: | 1.518 |
| Vapor_Pressure: | 1.7±0.3 mmHg at 25°C |
| MF: | C3H6N2O2 |
| Flash_Point: | 54.9±22.6 °C |
| LogP: | -1.75 |
| FW: | 102.092 |
| Density: | 1.4±0.1 g/cm3 |
| PSA: | 55.56000 |
| Bolling_Point: | 167.2±23.0 °C at 760 mmHg |
| Exact_Mass: | 102.042931 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)