Azelastine hydrochloride
Catalog No: FT-0659364
CAS No: 79307-93-0
- Chemical Name: Azelastine hydrochloride
- Molecular Formula: C22H25Cl2N3O
- Molecular Weight: 418.4
- InChI Key: YEJAJYAHJQIWNU-UHFFFAOYSA-N
- InChI: InChI=1S/C22H24ClN3O.ClH/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16;/h2-3,6-11,18H,4-5,12-15H2,1H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | azelastine hydrochloride |
|---|---|
| Bolling_Point: | 533.9ºC at 760 mmHg |
| MF: | C22H25Cl2N3O |
| Symbol: | GHS07 |
| Melting_Point: | 225-229ºC |
| CAS: | 79307-93-0 |
| Density: | 1.25 g/cm3 |
| FW: | 418.359 |
| Flash_Point: | 276.7ºC |
| Exact_Mass: | 417.137482 |
|---|---|
| Bolling_Point: | 533.9ºC at 760 mmHg |
| MF: | C22H25Cl2N3O |
| LogP: | 5.03740 |
| Density: | 1.25 g/cm3 |
| PSA: | 38.13000 |
| FW: | 418.359 |
| Flash_Point: | 276.7ºC |
| Melting_Point: | 225-229ºC |
| Warning_Statement: | P301 + P312 + P330 |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)