3-(1H-PYRROL-1-YL)THIOPHENE-2-CARBOXYLIC ACID
Catalog No: FT-0613502
CAS No: 74772-17-1
- Chemical Name: 3-(1H-PYRROL-1-YL)THIOPHENE-2-CARBOXYLIC ACID
- Molecular Formula: C9H7NO2S
- Molecular Weight: 193.22
- InChI Key: WSCYUZJLJQNLSQ-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-pyrrol-1-ylthiophene-2-carboxylic acid |
|---|---|
| Flash_Point: | 182ºC |
| Melting_Point: | 166ºC |
| FW: | 193.22200 |
| Density: | 1.37g/cm3 |
| CAS: | 74772-17-1 |
| Bolling_Point: | 377.3ºC at 760 mmHg |
| MF: | C9H7NO2S |
| Density: | 1.37g/cm3 |
|---|---|
| LogP: | 2.23700 |
| Flash_Point: | 182ºC |
| Melting_Point: | 166ºC |
| FW: | 193.22200 |
| PSA: | 70.47000 |
| Exact_Mass: | 193.02000 |
| MF: | C9H7NO2S |
| Bolling_Point: | 377.3ºC at 760 mmHg |
| Refractive_Index: | 1.669 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)