4-HYDROXY-7-AZAINDOLE
Catalog No: FT-0647262
CAS No: 74420-02-3
- Chemical Name: 4-HYDROXY-7-AZAINDOLE
- Molecular Formula: C7H6N2O
- Molecular Weight: 134.14
- InChI Key: IXIGMDXJXKDZOF-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N2O/c10-6-2-4-9-7-5(6)1-3-8-7/h1-4H,(H2,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 134.135 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 74420-02-3 |
| Bolling_Point: | N/A |
| Product_Name: | 4-Hydroxy-7-azaindole |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C7H6N2O |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.18 |
| Refractive_Index: | 1.760 |
| FW: | 134.135 |
| PSA: | 48.91000 |
| MF: | C7H6N2O |
| Exact_Mass: | 134.048019 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)