![1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol (CAS: 737003-45-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678336.png "1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol chemical structure")
1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
Catalog No: FT-0678336
CAS No: 737003-45-1
- Chemical Name: 1-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
- Molecular Formula: C8H8N2O
- Molecular Weight: 148.16
- InChI Key: KZIKASUARYIORO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8N2O/c1-10-3-2-6-4-7(11)5-9-8(6)10/h2-5,11H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 148.16200 |
| Density: | 1.27g/cm3 |
| CAS: | 737003-45-1 |
| Bolling_Point: | 335.5ºC at 760 mmHg |
| Product_Name: | 1-methylpyrrolo[2,3-b]pyridin-5-ol |
| Melting_Point: | N/A |
| Flash_Point: | 156.7ºC |
| MF: | C8H8N2O |
| Density: | 1.27g/cm3 |
|---|---|
| LogP: | 1.27890 |
| Flash_Point: | 156.7ºC |
| Refractive_Index: | 1.643 |
| FW: | 148.16200 |
| PSA: | 38.05000 |
| MF: | C8H8N2O |
| Bolling_Point: | 335.5ºC at 760 mmHg |
| Exact_Mass: | 148.06400 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
