6-bromo-2-chloroquinoline-3-carbaldehyde
Catalog No: FT-0739910
CAS No: 73568-35-1
- Chemical Name: 6-bromo-2-chloroquinoline-3-carbaldehyde
- Molecular Formula: C10H5BrClNO
- Molecular Weight: 270.51
- InChI Key: DCZCMZVZWKXJAF-UHFFFAOYSA-N
- InChI: InChI=1S/C10H5BrClNO/c11-8-1-2-9-6(4-8)3-7(5-14)10(12)13-9/h1-5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 73568-35-1 |
|---|---|
| MF: | C10H5BrClNO |
| Density: | 1.7±0.1 g/cm3 |
| Flash_Point: | 189.6±26.5 °C |
| Melting_Point: | 188-189ºC |
| Product_Name: | 6-Bromo-2-chloro-3-quinolinecarbaldehyde |
| Symbol: | GHS07 |
| Bolling_Point: | 389.8±37.0 °C at 760 mmHg |
| FW: | 270.510 |
| Bolling_Point: | 389.8±37.0 °C at 760 mmHg |
|---|---|
| Density: | 1.7±0.1 g/cm3 |
| MF: | C10H5BrClNO |
| LogP: | 3.39 |
| Melting_Point: | 188-189ºC |
| Exact_Mass: | 268.924286 |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 189.6±26.5 °C |
| FW: | 270.510 |
| Refractive_Index: | 1.715 |
| PSA: | 29.96000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302-H319 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)