2-PIPERIDINOBENZYLAMINE
Catalog No: FT-0613365
CAS No: 72752-54-6
- Chemical Name: 2-PIPERIDINOBENZYLAMINE
- Molecular Formula: C12H18N2
- Molecular Weight: 190.28
- InChI Key: VNNYEXSABSADDW-UHFFFAOYSA-N
- InChI: InChI=1S/C12H18N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-10,13H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-Piperidinobenzylamine |
|---|---|
| Flash_Point: | 135.8ºC |
| Melting_Point: | N/A |
| FW: | 190.28500 |
| Density: | 1.047g/cm3 |
| CAS: | 72752-54-6 |
| Bolling_Point: | 329.5ºC at 760 mmHg |
| MF: | C12H18N2 |
| Density: | 1.047g/cm3 |
|---|---|
| LogP: | 2.90090 |
| Flash_Point: | 135.8ºC |
| Refractive_Index: | 1.568 |
| FW: | 190.28500 |
| PSA: | 29.26000 |
| MF: | C12H18N2 |
| Bolling_Point: | 329.5ºC at 760 mmHg |
| Exact_Mass: | 190.14700 |
| Hazard_Codes: | C: Corrosive; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933399090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)