6-Methoxyquinoline-3-carboxamide
Catalog No: FT-0692906
CAS No: 71083-30-2
- Chemical Name: 6-Methoxyquinoline-3-carboxamide
- Molecular Formula: C11H10N2O2
- Molecular Weight: 202.21
- InChI Key: NLVPUORRLFNMCP-UHFFFAOYSA-N
- InChI: InChI=1S/C11H10N2O2/c1-15-9-2-3-10-7(5-9)4-8(6-13-10)11(12)14/h2-6H,1H3,(H2,12,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 202.20900 |
|---|---|
| CAS: | 71083-30-2 |
| Flash_Point: | 226.8ºC |
| MF: | C11H10N2O2 |
| Symbol: | Warning |
| Bolling_Point: | 451.5ºC at 760 mmHg |
| Melting_Point: | N/A |
| Product_Name: | 6-methoxyquinoline-3-carboxamide |
| Density: | 1.267g/cm3 |
| FW: | 202.20900 |
|---|---|
| MF: | C11H10N2O2 |
| Exact_Mass: | 202.07400 |
| Bolling_Point: | 451.5ºC at 760 mmHg |
| Refractive_Index: | 1.644 |
| PSA: | 65.21000 |
| LogP: | 2.04260 |
| Flash_Point: | 226.8ºC |
| Density: | 1.267g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302-H319 |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)