D(-)-Glutamic acid
Catalog No: FT-0624571
CAS No: 6893-26-1
- Chemical Name: D(-)-Glutamic acid
- Molecular Formula: C5H9NO4
- Molecular Weight: 147.13
- InChI Key: WHUUTDBJXJRKMK-UHFFFAOYSA-N
- InChI: InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 200-202ºC |
|---|---|
| CAS: | 6893-26-1 |
| MF: | C5H9NO4 |
| Flash_Point: | 155.7±25.1 °C |
| Product_Name: | D(-)-Glutamic acid |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 147.129 |
| Bolling_Point: | 333.8±32.0 °C at 760 mmHg |
| Refractive_Index: | 1.522 |
|---|---|
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| Flash_Point: | 155.7±25.1 °C |
| LogP: | -1.43 |
| Bolling_Point: | 333.8±32.0 °C at 760 mmHg |
| FW: | 147.129 |
| PSA: | 100.62000 |
| Melting_Point: | 200-202ºC |
| MF: | C5H9NO4 |
| Exact_Mass: | 147.053162 |
| Density: | 1.4±0.1 g/cm3 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2918990090 |
| Safety_Statements: | S24/25 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)