![4-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine (CAS: 688782-02-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0734288.png "4-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine chemical structure")
4-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine
Catalog No: FT-0734288
CAS No: 688782-02-7
- Chemical Name: 4-chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine
- Molecular Formula: C8H7ClN2
- Molecular Weight: 166.61
- InChI Key: PMHDZZGHIUEOIO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7ClN2/c1-5-4-11-8-7(5)6(9)2-3-10-8/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 688782-02-7 |
|---|---|
| MF: | C8H7ClN2 |
| Density: | 1.4±0.1 g/cm3 |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 4-Chloro-3-methyl-1H-pyrrolo[2,3-b]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 166.608 |
| MF: | C8H7ClN2 |
|---|---|
| LogP: | 2.97 |
| Exact_Mass: | 166.029770 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 166.608 |
| Refractive_Index: | 1.675 |
| PSA: | 28.68000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
