2,2-di(butan-2-yloxy)-1-phenylethanone
Catalog No: FT-0737306
CAS No: 68109-57-9
- Chemical Name: 2,2-di(butan-2-yloxy)-1-phenylethanone
- Molecular Formula: C16H24O3
- Molecular Weight: 264.36
- InChI Key: OHQSQCACEXDHAJ-UHFFFAOYSA-N
- InChI: InChI=1S/C16H24O3/c1-5-12(3)18-16(19-13(4)6-2)15(17)14-10-8-7-9-11-14/h7-13,16H,5-6H2,1-4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 264.36000 |
| CAS: | 68109-57-9 |
| MF: | C16H24O3 |
| Flash_Point: | 157.8ºC |
| Product_Name: | 2,2-di(butan-2-yloxy)-1-phenylethanone |
| Bolling_Point: | 351.8ºC at 760 mmHg |
| Density: | 0.99g/cm3 |
| FW: | 264.36000 |
|---|---|
| Refractive_Index: | 1.486 |
| MF: | C16H24O3 |
| Exact_Mass: | 264.17300 |
| LogP: | 3.82560 |
| Bolling_Point: | 351.8ºC at 760 mmHg |
| Density: | 0.99g/cm3 |
| PSA: | 35.53000 |
| Flash_Point: | 157.8ºC |