7-hydroxy-4-methyl-2,3-dihydroinden-1-one
Catalog No: FT-0732360
CAS No: 67901-82-0
- Chemical Name: 7-hydroxy-4-methyl-2,3-dihydroinden-1-one
- Molecular Formula: C10H10O2
- Molecular Weight: 162.18
- InChI Key: FXEWVKMVYBQMET-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10O2/c1-6-2-4-8(11)10-7(6)3-5-9(10)12/h2,4,11H,3,5H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 67901-82-0 |
|---|---|
| MF: | C10H10O2 |
| Density: | 1.25g/cm3 |
| Flash_Point: | 144.4ºC |
| Melting_Point: | 109-112ºC(lit.) |
| Product_Name: | 7-hydroxy-4-methyl-2,3-dihydroinden-1-one |
| Symbol: | GHS07 |
| Bolling_Point: | 339.3ºC at 760 mmHg |
| FW: | 162.18500 |
| Density: | 1.25g/cm3 |
|---|---|
| MF: | C10H10O2 |
| LogP: | 1.82950 |
| Melting_Point: | 109-112ºC(lit.) |
| Exact_Mass: | 162.06800 |
| Bolling_Point: | 339.3ºC at 760 mmHg |
| Flash_Point: | 144.4ºC |
| FW: | 162.18500 |
| Refractive_Index: | 1.614 |
| PSA: | 37.30000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26 |
| Warning_Statement: | P305 + P351 + P338 |
| Hazard_Codes: | Xn |
| HS_Code: | 2914400090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 22-36 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)