![2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid (CAS: 673-08-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0773219.png "2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid chemical structure")
2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid
Catalog No: FT-0773219
CAS No: 673-08-5
- Chemical Name: 2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]acetic acid
- Molecular Formula: C11H14N2O4
- Molecular Weight: 238.24
- InChI Key: HPYDSVWYXXKHRD-VIFPVBQESA-N
- InChI: InChI=1S/C11H14N2O4/c12-9(11(17)13-6-10(15)16)5-7-1-3-8(14)4-2-7/h1-4,9,14H,5-6,12H2,(H,13,17)(H,15,16)/t9-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 260-264ºC |
|---|---|
| FW: | 238.24000 |
| CAS: | 673-08-5 |
| MF: | C11H14N2O4 |
| Flash_Point: | 310.9ºC |
| Product_Name: | H-Tyr-Gly-OH |
| Bolling_Point: | 590.4ºC at 760 mmHg |
| Density: | 1.362g/cm3 |
| Melting_Point: | 260-264ºC |
|---|---|
| FW: | 238.24000 |
| Refractive_Index: | 1.605 |
| MF: | C11H14N2O4 |
| Exact_Mass: | 238.09500 |
| LogP: | 0.55400 |
| Bolling_Point: | 590.4ºC at 760 mmHg |
| Density: | 1.362g/cm3 |
| PSA: | 112.65000 |
| Flash_Point: | 310.9ºC |
| HS_Code: | 2924299090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)