Ethyl furo[3,2-b]pyrrole-5-carboxylate
Catalog No: FT-0678207
CAS No: 67268-37-5
- Chemical Name: Ethyl furo[3,2-b]pyrrole-5-carboxylate
- Molecular Formula: C7H5NO3
- Molecular Weight: 151.12
- InChI Key: MMAIBGHDBYQYDI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5NO3/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 151.11900 |
| Density: | 1.288g/cm3 |
| CAS: | 67268-37-5 |
| Bolling_Point: | 298.307ºC at 760 mmHg |
| Product_Name: | 4H-Furo[3,2-b]pyrrole-5-carboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | 134.212ºC |
| MF: | C7H5NO3 |
| Density: | 1.288g/cm3 |
|---|---|
| LogP: | 1.45910 |
| Flash_Point: | 134.212ºC |
| Refractive_Index: | 1.595 |
| FW: | 151.11900 |
| PSA: | 66.23000 |
| MF: | C7H5NO3 |
| Bolling_Point: | 298.307ºC at 760 mmHg |
| Exact_Mass: | 151.02700 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)