3-Methylaspartic acid
Catalog No: FT-0652773
CAS No: 6667-60-3
- Chemical Name: 3-Methylaspartic acid
- Molecular Formula: C5H9NO4
- Molecular Weight: 147.13
- InChI Key: LXRUAYBIUSUULX-UHFFFAOYSA-N
- InChI: InChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | DL-3-Methylaspartic acid |
|---|---|
| Bolling_Point: | 259.2±30.0 °C at 760 mmHg |
| Density: | 1.4±0.1 g/cm3 |
| MF: | C5H9NO4 |
| CAS: | 6667-60-3 |
| Melting_Point: | 270-276ºC |
| Flash_Point: | 110.6±24.6 °C |
| FW: | 147.129 |
| MF: | C5H9NO4 |
|---|---|
| Bolling_Point: | 259.2±30.0 °C at 760 mmHg |
| Exact_Mass: | 147.053162 |
| Melting_Point: | 270-276ºC |
| Refractive_Index: | 1.519 |
| PSA: | 100.62000 |
| Flash_Point: | 110.6±24.6 °C |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 147.129 |
| LogP: | -0.32 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| WGK_Germany: | 3 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| HS_Code: | 2922499990 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)