5'-Deoxy-5-fluorocytidine
Catalog No: FT-0641060
CAS No: 66335-38-4
- Chemical Name: 5'-Deoxy-5-fluorocytidine
- Molecular Formula: C9H12FN3O4
- Molecular Weight: 245.21
- InChI Key: YSNABXSEHNLERR-ZIYNGMLESA-N
- InChI: InChI=1S/C9H12FN3O4/c1-3-5(14)6(15)8(17-3)13-2-4(10)7(11)12-9(13)16/h2-3,5-6,8,14-15H,1H3,(H2,11,12,16)/t3-,5-,6-,8-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5'-Deoxy-5-fluorocytidine |
|---|---|
| Flash_Point: | 218.6±31.5 °C |
| Melting_Point: | 196-198ºC |
| FW: | 245.208 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 66335-38-4 |
| Bolling_Point: | 437.9±55.0 °C at 760 mmHg |
| MF: | C9H12FN3O4 |
| LogP: | -0.94 |
|---|---|
| Flash_Point: | 218.6±31.5 °C |
| Refractive_Index: | 1.700 |
| FW: | 245.208 |
| Bolling_Point: | 437.9±55.0 °C at 760 mmHg |
| Density: | 1.8±0.1 g/cm3 |
| Melting_Point: | 196-198ºC |
| PSA: | 110.60000 |
| Exact_Mass: | 245.081177 |
| Vapor_Pressure: | 0.0±2.4 mmHg at 25°C |
| MF: | C9H12FN3O4 |
| Hazard_Codes: | Xn: Harmful;Xi: Irritant; |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R20/21/22 |
| HS_Code: | 2934999090 |
| Safety_Statements: | 26-36-37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)