1-Pyrrolidinylacetic acid
Catalog No: FT-0688917
CAS No: 6628-74-6
- Chemical Name: 1-Pyrrolidinylacetic acid
- Molecular Formula: C6H12ClNO2
- Molecular Weight: 165.62
- InChI Key: HIGULTVOVROJID-UHFFFAOYSA-N
- InChI: InChI=1S/C6H11NO2.ClH/c8-6(9)5-7-3-1-2-4-7;/h1-5H2,(H,8,9);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 165.618 |
| Density: | N/A |
| CAS: | 6628-74-6 |
| Bolling_Point: | 269.9ºC at 760 mmHg |
| Product_Name: | 1-Pyrrolidinylacetic acid hydrochloride (1:1) |
| Melting_Point: | N/A |
| Flash_Point: | 117ºC |
| MF: | C6H12ClNO2 |
| LogP: | 0.90670 |
|---|---|
| Flash_Point: | 117ºC |
| FW: | 165.618 |
| PSA: | 40.54000 |
| MF: | C6H12ClNO2 |
| Bolling_Point: | 269.9ºC at 760 mmHg |
| Exact_Mass: | 165.055649 |
| Hazard_Codes: | Xi:IRRITANT |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Risk_Statements(EU): | R41 |
| Safety_Statements: | S39 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)