2-Chloro-1,3,2-dioxaphospholane-2-oxide
Catalog No: FT-0611683
CAS No: 6609-64-9
- Chemical Name: 2-Chloro-1,3,2-dioxaphospholane-2-oxide
- Molecular Formula: C2H4ClO3P
- Molecular Weight: 142.48
- InChI Key: SBMUNILHNJLMBF-UHFFFAOYSA-N
- InChI: InChI=1S/C2H4ClO3P/c3-7(4)5-1-2-6-7/h1-2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 6609-64-9 |
| Flash_Point: | -88.9±26.4 °C |
| Product_Name: | 2-Chloro-1,3,2-Dioxaphospholane 2-oxide |
| Bolling_Point: | 96.7±9.0 °C at 760 mmHg |
| FW: | 142.478 |
| Melting_Point: | 12-14 °C |
| MF: | C2H4ClO3P |
| Density: | 1.5±0.1 g/cm3 |
| Refractive_Index: | 1.435 |
|---|---|
| Vapor_Pressure: | 49.3±0.2 mmHg at 25°C |
| Flash_Point: | -88.9±26.4 °C |
| LogP: | 1.38010 |
| Bolling_Point: | 96.7±9.0 °C at 760 mmHg |
| FW: | 142.478 |
| PSA: | 45.34000 |
| Computational_Chemistry: | ['1. XlogP :0 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 355 ', '7. Heavy Atom Count :7 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :104 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 12-14 °C |
| MF: | C2H4ClO3P |
| Exact_Mass: | 141.958664 |
| Density: | 1.5±0.1 g/cm3 |
| Symbol: | GHS05 |
|---|---|
| Supplementary_Hazard_Statement: | Reacts violently with water. |
| RIDADR: | UN 3265 8/PG 2 |
| HS_Code: | 2934999090 |
| Packing_Group: | II |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R14;R34 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Codes: | C: Corrosive; |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)