6-chloro-Nmethylpyrimidin-4-amine
Catalog No: FT-0648197
CAS No: 65766-32-7
- Chemical Name: 6-chloro-Nmethylpyrimidin-4-amine
- Molecular Formula: C5H6ClN3
- Molecular Weight: 143.57
- InChI Key: WZVLJUBTIWFTIE-UHFFFAOYSA-N
- InChI: InChI=1S/C5H6ClN3/c1-7-5-2-4(6)8-3-9-5/h2-3H,1H3,(H,7,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 279.7±20.0 °C at 760 mmHg |
|---|---|
| CAS: | 65766-32-7 |
| MF: | C5H6ClN3 |
| Melting_Point: | N/A |
| Symbol: | Warning |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 143.574 |
| Product_Name: | 6-chloro-Nmethylpyrimidin-4-amine |
| Flash_Point: | 122.9±21.8 °C |
| Bolling_Point: | 279.7±20.0 °C at 760 mmHg |
|---|---|
| MF: | C5H6ClN3 |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.605 |
| Exact_Mass: | 143.025024 |
| PSA: | 37.81000 |
| LogP: | 1.88 |
| Flash_Point: | 122.9±21.8 °C |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| FW: | 143.574 |
| Symbol: | Warning |
|---|---|
| HS_Code: | 2933599090 |
| Safety_Statements: | H302-H315-H317-H319-H335 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)