2,3-DIAMINOPHENAZINE
Catalog No: FT-0609762
CAS No: 655-86-7
- Chemical Name: 2,3-DIAMINOPHENAZINE
- Molecular Formula: C12H10N4
- Molecular Weight: 210.23
- InChI Key: IYQHCPGJNZBANF-UHFFFAOYSA-N
- InChI: InChI=1S/C12H10N4/c13-7-5-6-10-12(11(7)14)16-9-4-2-1-3-8(9)15-10/h1-6H,13-14H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,3-Phenazinediamine |
|---|---|
| Bolling_Point: | 497.8±15.0 °C at 760 mmHg |
| MF: | C12H10N4 |
| Symbol: | GHS07 |
| Melting_Point: | >300ºC |
| CAS: | 655-86-7 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 210.235 |
| Flash_Point: | 287.1±7.6 °C |
| MF: | C12H10N4 |
|---|---|
| Bolling_Point: | 497.8±15.0 °C at 760 mmHg |
| Exact_Mass: | 210.090546 |
| Melting_Point: | >300ºC |
| Refractive_Index: | 1.853 |
| PSA: | 77.82000 |
| Flash_Point: | 287.1±7.6 °C |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 210.235 |
| LogP: | 1.82 |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Risk_Statements(EU): | R22 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard_Codes: | Xi: Irritant;Xn: Harmful; |
| RTECS: | SG1577650 |
| HS_Code: | 2933990090 |
| Safety_Statements: | 26-36/37 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)