GOSSYPIN
Catalog No: FT-0626803
CAS No: 652-78-8
- Chemical Name: GOSSYPIN
- Molecular Formula: C21H20O13
- Molecular Weight: 480.4
- InChI Key: SJRXVLUZMMDCNG-KKPQBLLMSA-N
- InChI: InChI=1S/C21H20O13/c22-5-11-13(27)15(29)17(31)21(32-11)34-19-10(26)4-9(25)12-14(28)16(30)18(33-20(12)19)6-1-2-7(23)8(24)3-6/h1-4,11,13,15,17,21-27,29-31H,5H2/t11-,13-,15+,17-,21+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 652-78-8 |
| Flash_Point: | 310.8ºC |
| Product_Name: | gossypin |
| Bolling_Point: | 886ºC at 760 mmHg |
| FW: | 480.37600 |
| Melting_Point: | 229-230ºC |
| MF: | C21H20O13 |
| Density: | 1.883 g/cm3 |
| Melting_Point: | 229-230ºC |
|---|---|
| Refractive_Index: | 1.799 |
| MF: | C21H20O13 |
| Flash_Point: | 310.8ºC |
| FW: | 480.37600 |
| Density: | 1.883 g/cm3 |
| PSA: | 230.74000 |
| Bolling_Point: | 886ºC at 760 mmHg |
| Exact_Mass: | 480.09000 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)