L(-)-Carvone
Catalog No: FT-0605067
CAS No: 6485-40-1
- Chemical Name: L(-)-Carvone
- Molecular Formula: C10H14O
- Molecular Weight: 150.22
- InChI Key: ULDHMXUKGWMISQ-SECBINFHSA-N
- InChI: InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 6485-40-1 |
| Flash_Point: | 88 ºC |
| Product_Name: | L(-)-Carvone |
| Bolling_Point: | 227-230 ºC |
| FW: | 150.218 |
| Melting_Point: | 25.2ºC |
| MF: | C10H14O |
| Density: | 0.958 |
| Refractive_Index: | 1.481 |
|---|---|
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| Flash_Point: | 88 ºC |
| LogP: | 2.27 |
| Bolling_Point: | 227-230 ºC |
| Water_Solubility: | PRACTICALLY INSOLUBLE |
| FW: | 150.218 |
| PSA: | 17.07000 |
| Vapor_Density: | 5.2 (vs air) |
| Computational_Chemistry: | ['1. XlogP :24 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :5 ', '6. TPSA 171 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :223 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 25.2ºC |
| MF: | C10H14O |
| Exact_Mass: | 150.104462 |
| Density: | 0.958 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| WGK_Germany: | 2 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RTECS: | OS8650000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| HS_Code: | 29142900 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)