2-BROMO-1-(4-PENTYLPHENYL)ETHAN-1-ONE
Catalog No: FT-0611348
CAS No: 64328-68-3
- Chemical Name: 2-BROMO-1-(4-PENTYLPHENYL)ETHAN-1-ONE
- Molecular Formula: C13H17BrO
- Molecular Weight: 269.18
- InChI Key: AVYNDJWQMUOSJZ-UHFFFAOYSA-N
- InChI: InChI=1S/C13H17BrO/c1-2-3-4-5-11-6-8-12(9-7-11)13(15)10-14/h6-9H,2-5,10H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-bromo-1-(4-pentylphenyl)ethanone |
|---|---|
| Flash_Point: | 35.5ºC |
| Melting_Point: | <30ºC |
| FW: | 269.17700 |
| Density: | 1.243g/cm3 |
| CAS: | 64328-68-3 |
| Bolling_Point: | 335.8ºC at 760 mmHg |
| MF: | C13H17BrO |
| Density: | 1.243g/cm3 |
|---|---|
| LogP: | 3.99690 |
| Flash_Point: | 35.5ºC |
| Melting_Point: | <30ºC |
| FW: | 269.17700 |
| PSA: | 17.07000 |
| Exact_Mass: | 268.04600 |
| MF: | C13H17BrO |
| Bolling_Point: | 335.8ºC at 760 mmHg |
| Refractive_Index: | 1.535 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2914700090 |
| Safety_Statements: | S26-S37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)