![[1-(4-chlorophenyl)cyclobutyl]methanamine (CAS: 63010-09-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0761002.png "[1-(4-chlorophenyl)cyclobutyl]methanamine chemical structure")
[1-(4-chlorophenyl)cyclobutyl]methanamine
Catalog No: FT-0761002
CAS No: 63010-09-3
- Chemical Name: [1-(4-chlorophenyl)cyclobutyl]methanamine
- Molecular Formula: C11H14ClN
- Molecular Weight: 195.69
- InChI Key: VJISRXVFSSVMQD-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14ClN/c12-10-4-2-9(3-5-10)11(8-13)6-1-7-11/h2-5H,1,6-8,13H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 63010-09-3 |
|---|---|
| MF: | C11H14ClN |
| Density: | 1.1±0.1 g/cm3 |
| Flash_Point: | 152.2±10.7 °C |
| Melting_Point: | N/A |
| Product_Name: | 1-[1-(4-Chlorophenyl)cyclobutyl]methanamine |
| Symbol: | GHS07 |
| Bolling_Point: | 285.4±23.0 °C at 760 mmHg |
| FW: | 195.689 |
| Bolling_Point: | 285.4±23.0 °C at 760 mmHg |
|---|---|
| Density: | 1.1±0.1 g/cm3 |
| MF: | C11H14ClN |
| LogP: | 2.94 |
| Exact_Mass: | 195.081482 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 152.2±10.7 °C |
| FW: | 195.689 |
| Refractive_Index: | 1.571 |
| PSA: | 26.02000 |
| Safety_Statements: | H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2921499090 |
| RIDADR: | NONH for all modes of transport |
