Triprolidine hydrochloride
Catalog No: FT-0635992
CAS No: 6138-79-0
- Chemical Name: Triprolidine hydrochloride
- Molecular Formula: C19H25ClN2O
- Molecular Weight: 332.9
- InChI Key: CUZMOIXUFHOLLN-UMVVUDSKSA-N
- InChI: InChI=1S/C19H22N2.ClH.H2O/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21;;/h2-3,6-12H,4-5,13-15H2,1H3;1H;1H2/b18-11+;;
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | triprolidine hydrochloride monohydrate |
|---|---|
| Bolling_Point: | 462ºC at 760 mmHg |
| MF: | C19H23ClN2 |
| Symbol: | GHS07 |
| Melting_Point: | 115-120ºC |
| CAS: | 6138-79-0 |
| Density: | N/A |
| FW: | 314.85200 |
| Flash_Point: | 233.2ºC |
| Melting_Point: | 115-120ºC |
|---|---|
| MF: | C19H23ClN2 |
| LogP: | 4.65740 |
| Bolling_Point: | 462ºC at 760 mmHg |
| Exact_Mass: | 314.15500 |
| FW: | 314.85200 |
| Flash_Point: | 233.2ºC |
| PSA: | 16.13000 |
| Risk_Statements(EU): | R22;R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard_Codes: | Xn:Harmful; |
| RTECS: | UT7658000 |
| Safety_Statements: | S26-S36 |
| WGK_Germany: | 3 |
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)