4-(2-Aminoethyl)benzoic acid hydrochloride
Catalog No: FT-0692295
CAS No: 60531-36-4
- Chemical Name: 4-(2-Aminoethyl)benzoic acid hydrochloride
- Molecular Formula: C9H12ClNO2
- Molecular Weight: 201.65
- InChI Key: GRQLJCQMQXXDTR-UHFFFAOYSA-N
- InChI: InChI=1S/C9H11NO2.ClH/c10-6-5-7-1-3-8(4-2-7)9(11)12;/h1-4H,5-6,10H2,(H,11,12);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-(2-Aminoethyl)benzoic acid hydrochloride |
|---|---|
| Bolling_Point: | 359.2ºC at 760 mmHg |
| MF: | C9H12ClNO2 |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | >350ºC(lit.) |
| CAS: | 60531-36-4 |
| Density: | N/A |
| FW: | 201.65000 |
| Flash_Point: | 171ºC |
| Melting_Point: | >350ºC(lit.) |
|---|---|
| MF: | C9H12ClNO2 |
| LogP: | 2.38830 |
| Bolling_Point: | 359.2ºC at 760 mmHg |
| Exact_Mass: | 201.05600 |
| FW: | 201.65000 |
| Flash_Point: | 171ºC |
| PSA: | 63.32000 |
| Risk_Statements(EU): | 37/38-41 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H302-H315-H318-H335 |
| HS_Code: | 2922499990 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS05, GHS07 |
| Hazard_Codes: | Xn |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)