PROXYPHYLLINE
Catalog No: FT-0603485
CAS No: 603-00-9
- Chemical Name: PROXYPHYLLINE
- Molecular Formula: C10H14N4O3
- Molecular Weight: 238.24
- InChI Key: KYHQZNGJUGFTGR-UHFFFAOYSA-N
- InChI: InChI=1S/C10H14N4O3/c1-6(15)4-14-5-11-8-7(14)9(16)13(3)10(17)12(8)2/h5-6,15H,4H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 603-00-9 |
| Flash_Point: | 248.5ºC |
| Product_Name: | Proxyphylline |
| Bolling_Point: | 487.2ºC |
| FW: | 238.24300 |
| Melting_Point: | 134-136ºC |
| MF: | C10H14N4O3 |
| Density: | 1.46 g/cm3 |
| Melting_Point: | 134-136ºC |
|---|---|
| Refractive_Index: | 1.664 |
| MF: | C10H14N4O3 |
| Flash_Point: | 248.5ºC |
| FW: | 238.24300 |
| Density: | 1.46 g/cm3 |
| PSA: | 82.05000 |
| Bolling_Point: | 487.2ºC |
| Exact_Mass: | 238.10700 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 22 |
| HS_Code: | 2939590000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)