DCVJ
Catalog No: FT-0616741
CAS No: 58293-56-4
- Chemical Name: DCVJ
- Molecular Formula: C16H15N3
- Molecular Weight: 249.31
- InChI Key: LROAUBRDKLVBCP-UHFFFAOYSA-N
- InChI: InChI=1S/C16H15N3/c17-10-13(11-18)7-12-8-14-3-1-5-19-6-2-4-15(9-12)16(14)19/h7-9H,1-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 249.31000 |
| Density: | 1.23 g/cm3 |
| CAS: | 58293-56-4 |
| Bolling_Point: | 470.7ºC at 760 mmHg |
| Product_Name: | 9-(2,2-Dicyanovinyl)julolidine |
| Melting_Point: | N/A |
| Flash_Point: | 214.6ºC |
| MF: | C16H15N3 |
| Density: | 1.23 g/cm3 |
|---|---|
| LogP: | 2.88096 |
| Flash_Point: | 214.6ºC |
| Refractive_Index: | 1.634 |
| FW: | 249.31000 |
| PSA: | 50.82000 |
| MF: | C16H15N3 |
| Bolling_Point: | 470.7ºC at 760 mmHg |
| Exact_Mass: | 249.12700 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | OO4445000 |
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)