GLYCIDAMIDE
Catalog No: FT-0624332
CAS No: 5694-00-8
- Chemical Name: GLYCIDAMIDE
- Molecular Formula: C3H5NO2
- Molecular Weight: 87.08
- InChI Key: FMAZQSYXRGRESX-UHFFFAOYSA-N
- InChI: InChI=1S/C3H5NO2/c4-3(5)2-1-6-2/h2H,1H2,(H2,4,5)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 87.077 |
|---|---|
| CAS: | 5694-00-8 |
| Flash_Point: | 240.8±21.2 °C |
| MF: | C3H5NO2 |
| Symbol: | Danger |
| Bolling_Point: | 321.9±31.0 °C at 760 mmHg |
| Melting_Point: | 32-34ºC |
| Product_Name: | UNII:6G5ELX5XYN |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 87.077 |
|---|---|
| MF: | C3H5NO2 |
| Exact_Mass: | 87.032028 |
| Flash_Point: | 240.8±21.2 °C |
| LogP: | -2.21 |
| PSA: | 55.62000 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Bolling_Point: | 321.9±31.0 °C at 760 mmHg |
| Melting_Point: | 32-34ºC |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.516 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|---|
| RTECS: | MB3200000 |
| Symbol: | GHS07, GHS08 |
| Warning_Statement: | P201-P261-P280-P305 + P351 + P338-P308 + P313 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302-H315-H317-H319-H335-H350 |
| HS_Code: | 2924299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)