![2-hydroxypropane-1,2,3-tricarboxylic acid;1-methyl-2-[(E)-2-thiophen-2-ylethenyl]-5,6-dihydro-4H-pyrimidine (CAS: 5685-86-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0774258.png "2-hydroxypropane-1,2,3-tricarboxylic acid;1-methyl-2-[(E)-2-thiophen-2-ylethenyl]-5,6-dihydro-4H-pyrimidine chemical structure")
2-hydroxypropane-1,2,3-tricarboxylic acid;1-methyl-2-[(E)-2-thiophen-2-ylethenyl]-5,6-dihydro-4H-pyrimidine
Catalog No: FT-0774258
CAS No: 5685-86-9
- Chemical Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;1-methyl-2-[(E)-2-thiophen-2-ylethenyl]-5,6-dihydro-4H-pyrimidine
- Molecular Formula: C17H22N2O7S
- Molecular Weight: 398.4
- InChI Key: YJGGCARNRYGSPA-IPZCTEOASA-N
- InChI: InChI=1S/C11H14N2S.C6H8O7/c1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10;7-3(8)1-6(13,5(11)12)2-4(9)10/h2,4-6,9H,3,7-8H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b6-5+;
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 5685-86-9 |
| Flash_Point: | 150ºC |
| Product_Name: | pyrantel citrate |
| Bolling_Point: | 324.4ºC at 760 mmHg |
| FW: | 398.43100 |
| Melting_Point: | N/A |
| MF: | C17H22N2O7S |
| Density: | N/A |
| MF: | C17H22N2O7S |
|---|---|
| Exact_Mass: | 398.11500 |
| LogP: | 0.62030 |
| Bolling_Point: | 324.4ºC at 760 mmHg |
| FW: | 398.43100 |
| PSA: | 175.97000 |
| Flash_Point: | 150ºC |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 23/24/25-36 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | T: Toxic; |
| Warning_Statement: | P301 + P312 + P330-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
