4-(4-Fluorobenzoyl)piperidine
Catalog No: FT-0616622
CAS No: 56346-57-7
- Chemical Name: 4-(4-Fluorobenzoyl)piperidine
- Molecular Formula: C12H14FNO
- Molecular Weight: 207.24
- InChI Key: ABERUOJGWHYBJL-UHFFFAOYSA-N
- InChI: InChI=1S/C12H14FNO/c13-11-3-1-9(2-4-11)12(15)10-5-7-14-8-6-10/h1-4,10,14H,5-8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 207.24400 |
| Density: | 1.054g/cm3 |
| CAS: | 56346-57-7 |
| Bolling_Point: | 310.7ºC at 760mmHg |
| Product_Name: | 4-(4-Fluorobenzoyl)piperidine |
| Melting_Point: | N/A |
| Flash_Point: | 125.3ºC |
| MF: | C12H14FNO |
| Density: | 1.054g/cm3 |
|---|---|
| LogP: | 2.33680 |
| Flash_Point: | 125.3ºC |
| Refractive_Index: | 1.536 |
| FW: | 207.24400 |
| PSA: | 29.10000 |
| MF: | C12H14FNO |
| Bolling_Point: | 310.7ºC at 760mmHg |
| Exact_Mass: | 207.10600 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)