Nitazoxanide
Catalog No: FT-0601547
CAS No: 55981-09-4
- Chemical Name: Nitazoxanide
- Molecular Formula: C12H9N3O5S
- Molecular Weight: 307.28
- InChI Key: YQNQNVDNTFHQSW-UHFFFAOYSA-N
- InChI: InChI=1S/C12H9N3O5S/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19/h2-6H,1H3,(H,13,14,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 55981-09-4 |
| Flash_Point: | N/A |
| Product_Name: | Nitazoxanide |
| Bolling_Point: | N/A |
| FW: | 307.282 |
| Melting_Point: | 202ºC |
| MF: | C12H9N3O5S |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 202ºC |
|---|---|
| Refractive_Index: | 1.673 |
| MF: | C12H9N3O5S |
| Exact_Mass: | 307.026276 |
| LogP: | 1.79 |
| FW: | 307.282 |
| Density: | 1.5±0.1 g/cm3 |
| PSA: | 142.35000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2942000000 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)