5-(2-Methoxyphenyl)cyclohexane-1,3-dione
Catalog No: FT-0679273
CAS No: 55579-77-6
- Chemical Name: 5-(2-Methoxyphenyl)cyclohexane-1,3-dione
- Molecular Formula: C13H14O3
- Molecular Weight: 218.25
- InChI Key: KDFGJXOGEXWKQI-UHFFFAOYSA-N
- InChI: InChI=1S/C13H14O3/c1-16-13-5-3-2-4-12(13)9-6-10(14)8-11(15)7-9/h2-5,9H,6-8H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 218.24800 |
| Density: | 1.163g/cm3 |
| CAS: | 55579-77-6 |
| Bolling_Point: | 380.01ºC at 760 mmHg |
| Product_Name: | 5-(2-methoxyphenyl)cyclohexane-1,3-dione |
| Melting_Point: | N/A |
| Flash_Point: | 170.216ºC |
| MF: | C13H14O3 |
| Density: | 1.163g/cm3 |
|---|---|
| LogP: | 2.10090 |
| Flash_Point: | 170.216ºC |
| Refractive_Index: | 1.542 |
| FW: | 218.24800 |
| PSA: | 43.37000 |
| MF: | C13H14O3 |
| Bolling_Point: | 380.01ºC at 760 mmHg |
| Exact_Mass: | 218.09400 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2914509090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)