Alantolactone
Catalog No: FT-0653947
CAS No: 546-43-0
- Chemical Name: Alantolactone
- Molecular Formula: C15H20O2
- Molecular Weight: 232.32
- InChI Key: PXOYOCNNSUAQNS-AGNJHWRGSA-N
- InChI: InChI=1S/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h7,9,11,13H,2,4-6,8H2,1,3H3/t9-,11+,13+,15+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 546-43-0 |
| Flash_Point: | 111.5±18.2 °C |
| Product_Name: | Alantolactone |
| Bolling_Point: | 275.0±0.0 °C at 760 mmHg |
| FW: | 232.318 |
| Melting_Point: | 78-79ºC |
| MF: | C15H20O2 |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.534 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 111.5±18.2 °C |
| LogP: | 3.69 |
| Bolling_Point: | 275.0±0.0 °C at 760 mmHg |
| FW: | 232.318 |
| PSA: | 26.30000 |
| Melting_Point: | 78-79ºC |
| MF: | C15H20O2 |
| Exact_Mass: | 232.146332 |
| Density: | 1.1±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2932209090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P280 |
| Safety_Statements: | H317 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)