2,5-DIMETHYLBENZOYLACETONITRILE
Catalog No: FT-0604182
CAS No: 53882-93-2
- Chemical Name: 2,5-DIMETHYLBENZOYLACETONITRILE
- Molecular Formula: C11H11NO
- Molecular Weight: 173.21
- InChI Key: WBEDLANIZRGOMS-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11NO/c1-8-3-4-9(2)10(7-8)11(13)5-6-12/h3-4,7H,5H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-(2,5-Dimethylphenyl)-3-oxopropanenitrile |
|---|---|
| Flash_Point: | 153.8±24.6 °C |
| Melting_Point: | N/A |
| FW: | 173.211 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 53882-93-2 |
| Bolling_Point: | 330.7±30.0 °C at 760 mmHg |
| MF: | C11H11NO |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 1.89 |
| Flash_Point: | 153.8±24.6 °C |
| Refractive_Index: | 1.530 |
| FW: | 173.211 |
| PSA: | 40.86000 |
| MF: | C11H11NO |
| Bolling_Point: | 330.7±30.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 173.084061 |
| HS_Code: | 2926909090 |
|---|