4-Amino-2-methoxy-phenol
Catalog No: FT-0678746
CAS No: 52200-90-5
- Chemical Name: 4-Amino-2-methoxy-phenol
- Molecular Formula: C7H9NO2
- Molecular Weight: 139.15
- InChI Key: MCNBYOWWTITHIG-UHFFFAOYSA-N
- InChI: InChI=1S/C7H9NO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,8H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 52200-90-5 |
| Flash_Point: | 140.1±23.7 °C |
| Product_Name: | 4-Amino-2-methoxyphenol |
| Bolling_Point: | 308.1±27.0 °C at 760 mmHg |
| FW: | 139.152 |
| Melting_Point: | N/A |
| MF: | C7H9NO2 |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.600 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C7H9NO2 |
| Flash_Point: | 140.1±23.7 °C |
| LogP: | -0.60 |
| FW: | 139.152 |
| Density: | 1.2±0.1 g/cm3 |
| PSA: | 55.48000 |
| Bolling_Point: | 308.1±27.0 °C at 760 mmHg |
| Exact_Mass: | 139.063324 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922509090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)