FRANGULIN A
Catalog No: FT-0603443
CAS No: 521-62-0
- Chemical Name: FRANGULIN A
- Molecular Formula: C21H20O9
- Molecular Weight: 416.4
- InChI Key: DTTVUKLWJFJOHO-FUCRAMRQSA-N
- InChI: InChI=1S/C21H20O9/c1-7-3-10-14(12(22)4-7)18(26)15-11(17(10)25)5-9(6-13(15)23)30-21-20(28)19(27)16(24)8(2)29-21/h3-6,8,16,19-24,27-28H,1-2H3/t8-,16-,19+,20+,21-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1,8-dihydroxy-3-methyl-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyanthracene-9,10-dione |
|---|---|
| Bolling_Point: | 744.3ºC at 760 mmHg |
| MF: | C21H20O9 |
| Symbol: | GHS07 |
| Melting_Point: | 230ºC |
| CAS: | 521-62-0 |
| Density: | 1.597 g/cm3 |
| FW: | 416.37800 |
| Flash_Point: | 265.9ºC |
| Exact_Mass: | 416.11100 |
|---|---|
| Refractive_Index: | 1.706 |
| LogP: | 0.38790 |
| MF: | C21H20O9 |
| Bolling_Point: | 744.3ºC at 760 mmHg |
| Density: | 1.597 g/cm3 |
| PSA: | 153.75000 |
| FW: | 416.37800 |
| Flash_Point: | 265.9ºC |
| Melting_Point: | 230ºC |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)