DIOSMETIN
Catalog No: FT-0603442
CAS No: 520-34-3
- Chemical Name: DIOSMETIN
- Molecular Formula: C16H12O6
- Molecular Weight: 300.26
- InChI Key: MBNGWHIJMBWFHU-UHFFFAOYSA-N
- InChI: InChI=1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 520-34-3 |
| Flash_Point: | 220.3±23.6 °C |
| Product_Name: | Diosmetin |
| Bolling_Point: | 576.7±50.0 °C at 760 mmHg |
| FW: | 300.263 |
| Melting_Point: | 256-258ºC |
| MF: | C16H12O6 |
| Density: | 1.5±0.1 g/cm3 |
| Refractive_Index: | 1.697 |
|---|---|
| Vapor_Pressure: | 0.0±1.7 mmHg at 25°C |
| Flash_Point: | 220.3±23.6 °C |
| LogP: | 3.10 |
| Bolling_Point: | 576.7±50.0 °C at 760 mmHg |
| FW: | 300.263 |
| PSA: | 100.13000 |
| Melting_Point: | 256-258ºC |
| MF: | C16H12O6 |
| Exact_Mass: | 300.063385 |
| Density: | 1.5±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2942000000 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)