2-Bromo-4-fomylthiazole
Catalog No: FT-0635577
CAS No: 5198-80-1
- Chemical Name: 2-Bromo-4-fomylthiazole
- Molecular Formula: C4H2BrNOS
- Molecular Weight: 192.04
- InChI Key: MNQVIZWWCRPZOK-UHFFFAOYSA-N
- InChI: InChI=1S/C4H2BrNOS/c5-4-6-3(1-7)2-8-4/h1-2H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-Bromo-1,3-thiazole-2-carbaldehyde |
|---|---|
| Bolling_Point: | 264.9±13.0 °C at 760 mmHg |
| MF: | C4H2BrNOS |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | 132-135ºC |
| CAS: | 5198-80-1 |
| Density: | 1.9±0.1 g/cm3 |
| FW: | 192.034 |
| Flash_Point: | 114.0±19.8 °C |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
|---|---|
| Exact_Mass: | 190.904037 |
| Refractive_Index: | 1.666 |
| LogP: | 1.35 |
| Bolling_Point: | 264.9±13.0 °C at 760 mmHg |
| Density: | 1.9±0.1 g/cm3 |
| MF: | C4H2BrNOS |
| PSA: | 58.20000 |
| FW: | 192.034 |
| Flash_Point: | 114.0±19.8 °C |
| Melting_Point: | 132-135ºC |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2934100090 |
| Safety_Statements: | H302-H317-H318 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Symbol: | GHS05, GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)