SodiuM dichloroisocyanurate dihydrate
Catalog No: FT-0774670
CAS No: 51580-86-0
- Chemical Name: SodiuM dichloroisocyanurate dihydrate
- Molecular Formula: C3H4Cl2N3NaO5
- Molecular Weight: 255.97
- InChI Key: PYILKOIEIHHYGD-UHFFFAOYSA-M
- InChI: InChI=1S/C3HCl2N3O3.Na.2H2O/c4-7-1(9)6-2(10)8(5)3(7)11;;;/h(H,6,9,10);;2*1H2/q;+1;;/p-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS09 |
|---|---|
| CAS: | 51580-86-0 |
| Flash_Point: | N/A |
| Product_Name: | Dichloroisocyanuric acid sodium salt dihydrate |
| Bolling_Point: | N/A |
| FW: | 255.97700 |
| Melting_Point: | 245ºC (dec.) |
| MF: | C3H4Cl2N3NaO5 |
| Density: | N/A |
| Melting_Point: | 245ºC (dec.) |
|---|---|
| MF: | C3H4Cl2N3NaO5 |
| Exact_Mass: | 254.94300 |
| FW: | 255.97700 |
| PSA: | 98.41000 |
| Symbol: | GHS07, GHS09 |
|---|---|
| Supplementary_Hazard_Statement: | Contact with acids liberates toxic gas. |
| Risk_Statements(EU): | R8;R22;R31;R36/37;R50/53 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | XZ1910000 |
| RIDADR: | UN 3077 |
| Hazard_Codes: | O;Xn;N |
| Warning_Statement: | P273-P301 + P312 + P330-P305 + P351 + P338-P391-P501 |
| Safety_Statements: | H302-H319-H335-H410 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)