4-Bromo-2,6-dimethylpyridine
Catalog No: FT-0647585
CAS No: 5093-70-9
- Chemical Name: 4-Bromo-2,6-dimethylpyridine
- Molecular Formula: C7H8BrN
- Molecular Weight: 186.05
- InChI Key: VTRFAYHJKSKHGY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8BrN/c1-5-3-7(8)4-6(2)9-5/h3-4H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 186.049 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 5093-70-9 |
| Bolling_Point: | 207.3±35.0 °C at 760 mmHg |
| Product_Name: | 4-Bromo-2,6-dimethylpyridine |
| Melting_Point: | N/A |
| Flash_Point: | 79.2±25.9 °C |
| MF: | C7H8BrN |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.46 |
| Flash_Point: | 79.2±25.9 °C |
| Refractive_Index: | 1.547 |
| FW: | 186.049 |
| PSA: | 12.89000 |
| MF: | C7H8BrN |
| Bolling_Point: | 207.3±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.3±0.4 mmHg at 25°C |
| Exact_Mass: | 184.984009 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)