4,6-Dichloro-5-methoxypyrimidine
Catalog No: FT-0600945
CAS No: 5018-38-2
- Chemical Name: 4,6-Dichloro-5-methoxypyrimidine
- Molecular Formula: C5H4Cl2N2O
- Molecular Weight: 179
- InChI Key: IJQIGKLDBGKSNT-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4Cl2N2O/c1-10-3-4(6)8-2-9-5(3)7/h2H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 5018-38-2 |
| Flash_Point: | 109.7±25.9 °C |
| Product_Name: | 4,6-Dichloro-5-methoxypyrimidine |
| Bolling_Point: | 257.8±35.0 °C at 760 mmHg |
| FW: | 179.004 |
| Melting_Point: | 66-68ºC |
| MF: | C5H4Cl2N2O |
| Density: | 1.4±0.1 g/cm3 |
| Melting_Point: | 66-68ºC |
|---|---|
| Refractive_Index: | 1.541 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C5H4Cl2N2O |
| Flash_Point: | 109.7±25.9 °C |
| LogP: | 1.57 |
| FW: | 179.004 |
| Density: | 1.4±0.1 g/cm3 |
| PSA: | 35.01000 |
| Bolling_Point: | 257.8±35.0 °C at 760 mmHg |
| Exact_Mass: | 177.970062 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933599090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)