Bergaptol
Catalog No: FT-0663072
CAS No: 486-60-2
- Chemical Name: Bergaptol
- Molecular Formula: C11H6O4
- Molecular Weight: 202.16
- InChI Key: GIJHDGJRTUSBJR-UHFFFAOYSA-N
- InChI: InChI=1S/C11H6O4/c12-10-2-1-6-9(15-10)5-8-7(11(6)13)3-4-14-8/h1-5,13H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Bergaptol |
|---|---|
| Bolling_Point: | 311.9±11.0 °C at 760 mmHg |
| MF: | C11H6O4 |
| Symbol: | GHS07 |
| Melting_Point: | 287-290ºC |
| CAS: | 486-60-2 |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 202.163 |
| Flash_Point: | 142.4±19.3 °C |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
|---|---|
| Exact_Mass: | 202.026611 |
| Refractive_Index: | 1.711 |
| LogP: | 0.93 |
| Bolling_Point: | 311.9±11.0 °C at 760 mmHg |
| Density: | 1.5±0.1 g/cm3 |
| MF: | C11H6O4 |
| PSA: | 63.58000 |
| FW: | 202.163 |
| Flash_Point: | 142.4±19.3 °C |
| Melting_Point: | 287-290ºC |
| Safety_Statements: | 22-24/25 |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)