Pinostrobin
Catalog No: FT-0632188
CAS No: 480-37-5
- Chemical Name: Pinostrobin
- Molecular Formula: C16H14O4
- Molecular Weight: 270.28
- InChI Key: ORJDDOBAOGKRJV-UHFFFAOYSA-N
- InChI: InChI=1S/C16H14O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-8,14,17H,9H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 270.280 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 480-37-5 |
| Bolling_Point: | 494.9±45.0 °C at 760 mmHg |
| Product_Name: | Pinocembrin-7-methyl ether |
| Melting_Point: | 100ºC |
| Flash_Point: | 188.8±22.2 °C |
| MF: | C16H14O4 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 4.11 |
| Flash_Point: | 188.8±22.2 °C |
| Melting_Point: | 100ºC |
| FW: | 270.280 |
| PSA: | 55.76000 |
| Exact_Mass: | 270.089203 |
| MF: | C16H14O4 |
| Bolling_Point: | 494.9±45.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.3 mmHg at 25°C |
| Refractive_Index: | 1.612 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2932999099 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)