5-Benzyloxy-6-methoxyindole
Catalog No: FT-0662897
CAS No: 4790-04-9
- Chemical Name: 5-Benzyloxy-6-methoxyindole
- Molecular Formula: C16H15NO2
- Molecular Weight: 253.29
- InChI Key: XDLZHWUPJHWVFK-UHFFFAOYSA-N
- InChI: InChI=1S/C16H15NO2/c1-18-15-10-14-13(7-8-17-14)9-16(15)19-11-12-5-3-2-4-6-12/h2-10,17H,11H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 253.29600 |
|---|---|
| CAS: | 4790-04-9 |
| Melting_Point: | 93-94ºC |
| Bolling_Point: | 430.9ºC at 760mmHg |
| MF: | C16H15NO2 |
| Product_Name: | 5-Benzyloxy-6-methoxyindole |
| Flash_Point: | 155.3ºC |
| Density: | 1.202g/cm3 |
| FW: | 253.29600 |
|---|---|
| MF: | C16H15NO2 |
| Exact_Mass: | 253.11000 |
| Flash_Point: | 155.3ºC |
| LogP: | 3.75550 |
| PSA: | 34.25000 |
| Refractive_Index: | 1.645 |
| Bolling_Point: | 430.9ºC at 760mmHg |
| Melting_Point: | 93-94ºC |
| Density: | 1.202g/cm3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)