5-Bromopyridine-3,4-diamine
Catalog No: FT-0687555
CAS No: 4635-08-9
- Chemical Name: 5-Bromopyridine-3,4-diamine
- Molecular Formula: C5H6BrN3
- Molecular Weight: 188.03
- InChI Key: CMFSWSZEHYPECE-UHFFFAOYSA-N
- InChI: InChI=1S/C5H6BrN3/c6-3-1-9-2-4(7)5(3)8/h1-2H,7H2,(H2,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-Bromopyridine-3,4-diamine |
|---|---|
| Bolling_Point: | 370.1±37.0 °C at 760 mmHg |
| MF: | C5H6BrN3 |
| Symbol: | GHS07 |
| Melting_Point: | N/A |
| CAS: | 4635-08-9 |
| Density: | 1.8±0.1 g/cm3 |
| FW: | 188.025 |
| Flash_Point: | 177.6±26.5 °C |
| Exact_Mass: | 186.974503 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C5H6BrN3 |
| LogP: | 1.82 |
| Bolling_Point: | 370.1±37.0 °C at 760 mmHg |
| Density: | 1.8±0.1 g/cm3 |
| PSA: | 64.93000 |
| FW: | 188.025 |
| Flash_Point: | 177.6±26.5 °C |
| Refractive_Index: | 1.712 |
| RTECS: | US4000000 |
|---|---|
| HS_Code: | 2933399090 |
| Safety_Statements: | H302-H315-H317-H319-H335 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)