![benzo[f]chromen-3-one (CAS: 4352-89-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0755108.png "benzo[f]chromen-3-one chemical structure")
benzo[f]chromen-3-one
Catalog No: FT-0755108
CAS No: 4352-89-0
- Chemical Name: benzo[f]chromen-3-one
- Molecular Formula: C13H8O2
- Molecular Weight: 196.2
- InChI Key: FXRDPPFLWGSMQT-UHFFFAOYSA-N
- InChI: InChI=1S/C13H8O2/c14-13-8-6-11-10-4-2-1-3-9(10)5-7-12(11)15-13/h1-8H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 117－119ºC |
|---|---|
| FW: | 196.20100 |
| CAS: | 4352-89-0 |
| MF: | C13H8O2 |
| Flash_Point: | 169.7ºC |
| Product_Name: | 3H-naphtho(2,1-b)pyran-3-one |
| Bolling_Point: | 402.6ºC at 760 mmHg |
| Density: | 1.297 |
| Melting_Point: | 117－119ºC |
|---|---|
| FW: | 196.20100 |
| Refractive_Index: | 1.687 |
| MF: | C13H8O2 |
| Exact_Mass: | 196.05200 |
| LogP: | 2.94620 |
| Bolling_Point: | 402.6ºC at 760 mmHg |
| Density: | 1.297 |
| PSA: | 30.21000 |
| Flash_Point: | 169.7ºC |
| HS_Code: | 2914399090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)