2-Chloro-5-nitronicotinic acid
Catalog No: FT-0649835
CAS No: 42959-38-6
- Chemical Name: 2-Chloro-5-nitronicotinic acid
- Molecular Formula: C6H3ClN2O4
- Molecular Weight: 202.55
- InChI Key: WOFZRBCITDVRON-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3ClN2O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 202.552 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 42959-38-6 |
| Bolling_Point: | 384.8±42.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-5-nitronicotinic acid |
| Melting_Point: | N/A |
| Flash_Point: | 186.5±27.9 °C |
| MF: | C6H3ClN2O4 |
| Density: | 1.7±0.1 g/cm3 |
|---|---|
| LogP: | 0.46 |
| Flash_Point: | 186.5±27.9 °C |
| Refractive_Index: | 1.637 |
| FW: | 202.552 |
| PSA: | 96.01000 |
| MF: | C6H3ClN2O4 |
| Bolling_Point: | 384.8±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Exact_Mass: | 201.978134 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)